C11H13NO3 — CID 69336579
N-(1,3-dioxolan-4-ylmethyl)benzamide (PubChem CID 69336579) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(1,3-dioxolan-4-ylmethyl)benzamide.
| Compound Name | N-(1,3-dioxolan-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 69336579 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-(1,3-dioxolan-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1COCO1)c1ccccc1 |
| InChI | InChI=1S/C11H13NO3/c13-11(9-4-2-1-3-5-9)12-6-10-7-14-8-15-10/h1-5,10H,6-8H2,(H,12,13) |
| InChIKey | NBCZZLUBQJXLMV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |