C26H25FN4O3 — CID 69337383
3-[[1-(2-fluorophenyl)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl]amino]benzamide (PubChem CID 69337383) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is 3-[[1-(2-fluorophenyl)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl]amino]benzamide.
| Compound Name | 3-[[1-(2-fluorophenyl)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 69337383 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3-[[1-(2-fluorophenyl)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(C(=O)Nc2ccc(N3CCCCC3=O)cc2)c2ccccc2F)c1 |
| InChI | InChI=1S/C26H25FN4O3/c27-22-9-2-1-8-21(22)24(29-19-7-5-6-17(16-19)25(28)33)26(34)30-18-11-13-20(14-12-18)31-15-4-3-10-23(31)32/h1-2,5-9,11-14,16,24,29H,3-4,10,15H2,(H2,28,33)(H,30,34) |
| InChIKey | CZEOQMAYXCZMRT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |