C27H30FN5O2 — CID 10310922
2-[3-(aminomethyl)anilino]-2-(2-fluorophenyl)-N-[4-[(2E)-2-hydroxyiminopiperidin-1-yl]-3-methylphenyl]acetamide (PubChem CID 10310922) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[3-(aminomethyl)anilino]-2-(2-fluorophenyl)-N-[4-[(2E)-2-hydroxyiminopiperidin-1-yl]-3-methylphenyl]acetamide.
| Compound Name | 2-[3-(aminomethyl)anilino]-2-(2-fluorophenyl)-N-[4-[(2E)-2-hydroxyiminopiperidin-1-yl]-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 10310922 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-[3-(aminomethyl)anilino]-2-(2-fluorophenyl)-N-[4-[(2E)-2-hydroxyiminopiperidin-1-yl]-3-methylphenyl]acetamide |
| SMILES | Cc1cc(NC(=O)C(Nc2cccc(CN)c2)c2ccccc2F)ccc1N1CCCC/C1=N\O |
| InChI | InChI=1S/C27H30FN5O2/c1-18-15-21(12-13-24(18)33-14-5-4-11-25(33)32-35)31-27(34)26(22-9-2-3-10-23(22)28)30-20-8-6-7-19(16-20)17-29/h2-3,6-10,12-13,15-16,26,30,35H,4-5,11,14,17,29H2,1H3,(H,31,34)/b32-25+ |
| InChIKey | GYMVAIHXWGAWLS-WGPBWIAQSA-N |
| XLogP | 5.16 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|