C27H30N4O2 — CID 69337429
2-[3-(aminomethyl)anilino]-N-methyl-N-[4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 69337429) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[3-(aminomethyl)anilino]-N-methyl-N-[4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-[3-(aminomethyl)anilino]-N-methyl-N-[4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 69337429 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-[3-(aminomethyl)anilino]-N-methyl-N-[4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | CN(C(=O)C(Nc1cccc(CN)c1)c1ccccc1)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C27H30N4O2/c1-30(23-13-15-24(16-14-23)31-17-6-5-12-25(31)32)27(33)26(21-9-3-2-4-10-21)29-22-11-7-8-20(18-22)19-28/h2-4,7-11,13-16,18,26,29H,5-6,12,17,19,28H2,1H3 |
| InChIKey | RXMRDURBROBCHF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |