C25H26FN5O2 — CID 10388923
1-(N-[3-(aminomethyl)phenyl]-4-fluoroanilino)-3-[4-(2-oxopiperidin-1-yl)phenyl]urea (PubChem CID 10388923) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is 1-(N-[3-(aminomethyl)phenyl]-4-fluoroanilino)-3-[4-(2-oxopiperidin-1-yl)phenyl]urea.
| Compound Name | 1-(N-[3-(aminomethyl)phenyl]-4-fluoroanilino)-3-[4-(2-oxopiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 10388923 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-(N-[3-(aminomethyl)phenyl]-4-fluoroanilino)-3-[4-(2-oxopiperidin-1-yl)phenyl]urea |
| SMILES | NCc1cccc(N(NC(=O)Nc2ccc(N3CCCCC3=O)cc2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H26FN5O2/c26-19-7-11-22(12-8-19)31(23-5-3-4-18(16-23)17-27)29-25(33)28-20-9-13-21(14-10-20)30-15-2-1-6-24(30)32/h3-5,7-14,16H,1-2,6,15,17,27H2,(H2,28,29,33) |
| InChIKey | RZMJGKMJOQOBCC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|