C27H30N4O2 — CID 69337781
2-[3-(aminomethyl)anilino]-N-[4-ethyl-3-(2-oxopyrrolidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 69337781) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[3-(aminomethyl)anilino]-N-[4-ethyl-3-(2-oxopyrrolidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-[3-(aminomethyl)anilino]-N-[4-ethyl-3-(2-oxopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 69337781 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-[3-(aminomethyl)anilino]-N-[4-ethyl-3-(2-oxopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | CCc1ccc(NC(=O)C(Nc2cccc(CN)c2)c2ccccc2)cc1N1CCCC1=O |
| InChI | InChI=1S/C27H30N4O2/c1-2-20-13-14-23(17-24(20)31-15-7-12-25(31)32)30-27(33)26(21-9-4-3-5-10-21)29-22-11-6-8-19(16-22)18-28/h3-6,8-11,13-14,16-17,26,29H,2,7,12,15,18,28H2,1H3,(H,30,33) |
| InChIKey | RKXNWJFINDFOFT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |