C23H35NO2 — CID 69338735
1-cyclopentyl-2-[(dimethylamino)methyl]-7-[(4-methoxyphenyl)methylidene]cycloheptan-1-ol (PubChem CID 69338735) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(dimethylamino)methyl]-7-[(4-methoxyphenyl)methylidene]cycloheptan-1-ol.
| Compound Name | 1-cyclopentyl-2-[(dimethylamino)methyl]-7-[(4-methoxyphenyl)methylidene]cycloheptan-1-ol |
|---|---|
| PubChem CID | 69338735 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 1-cyclopentyl-2-[(dimethylamino)methyl]-7-[(4-methoxyphenyl)methylidene]cycloheptan-1-ol |
| SMILES | COc1ccc(C=C2CCCCC(CN(C)C)C2(O)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H35NO2/c1-24(2)17-21-11-7-6-10-20(23(21,25)19-8-4-5-9-19)16-18-12-14-22(26-3)15-13-18/h12-16,19,21,25H,4-11,17H2,1-3H3 |
| InChIKey | NKOMCDDFEYSKKP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |