C24H31NO2 — CID 69339642
(6E)-1-benzyl-2-[(dimethylamino)methyl]-6-[(4-methoxyphenyl)methylidene]cyclohexan-1-ol (PubChem CID 69339642) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (6E)-1-benzyl-2-[(dimethylamino)methyl]-6-[(4-methoxyphenyl)methylidene]cyclohexan-1-ol.
| Compound Name | (6E)-1-benzyl-2-[(dimethylamino)methyl]-6-[(4-methoxyphenyl)methylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 69339642 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (6E)-1-benzyl-2-[(dimethylamino)methyl]-6-[(4-methoxyphenyl)methylidene]cyclohexan-1-ol |
| SMILES | COc1ccc(/C=C2\CCCC(CN(C)C)C2(O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO2/c1-25(2)18-22-11-7-10-21(16-19-12-14-23(27-3)15-13-19)24(22,26)17-20-8-5-4-6-9-20/h4-6,8-9,12-16,22,26H,7,10-11,17-18H2,1-3H3/b21-16+ |
| InChIKey | IAYYQYIWKBZFKF-LTGZKZEYSA-N |
| XLogP | 4.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |