2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid

C11H17NO3 — CID 69340391

IUPAC2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid
SMILESC=CC(C=C(C)C(=O)O)N1CCOCC1
InChIInChI=1S/C11H17NO3/c1-3-10(8-9(2)11(13)14)12-4-6-15-7-5-12/h3,8,10H,1,4-7H2,2H3,(H,13,14)
InChIKeyAMWSGTUZXNLGMN-UHFFFAOYSA-N
MW211.26 g/mol
LogP0.90
Rot. Bonds4

About 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid

2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid (PubChem CID 69340391) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid.

Molecular Properties

Compound Name2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid
PubChem CID69340391
Molecular FormulaC11H17NO3
Molecular Weight211.26 g/mol
Exact Mass211.12
IUPAC Name2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid
SMILESC=CC(C=C(C)C(=O)O)N1CCOCC1
InChIInChI=1S/C11H17NO3/c1-3-10(8-9(2)11(13)14)12-4-6-15-7-5-12/h3,8,10H,1,4-7H2,2H3,(H,13,14)
InChIKeyAMWSGTUZXNLGMN-UHFFFAOYSA-N
XLogP0.90
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.26
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid?
The IUPAC name of 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid (CID 69340391) is 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid.
What is the SMILES notation for 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid?
The canonical SMILES for 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid is C=CC(C=C(C)C(=O)O)N1CCOCC1.
What is the InChIKey of 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid?
The InChIKey is AMWSGTUZXNLGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-3-10(8-9(2)11(13)14)12-4-6-15-7-5-12/h3,8,10H,1,4-7H2,2H3,(H,13,14).
What are the key properties of 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid?
2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid has a molecular weight of 211.26 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-morpholin-4-ylhexa-2,5-dienoic acid is sourced from PubChem (CID 69340391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).