C23H17Cl2IN2O2 — CID 69340572
(3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 69340572) has the molecular formula C23H17Cl2IN2O2 and a molecular weight of 551.21 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 69340572 |
| Molecular Formula | C23H17Cl2IN2O2 |
| Molecular Weight | 551.21 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-4-[(1R)-1-(4-chlorophenyl)ethyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | C[C@H](c1ccc(Cl)cc1)N1C(=O)c2cc(I)ccc2NC(=O)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2IN2O2/c1-13(14-2-6-16(24)7-3-14)28-21(15-4-8-17(25)9-5-15)22(29)27-20-11-10-18(26)12-19(20)23(28)30/h2-13,21H,1H3,(H,27,29)/t13-,21+/m1/s1 |
| InChIKey | YEXWDBBRVSEZLG-ASSNKEHSSA-N |
| XLogP | 6.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.21 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|