C22H15Cl2IN2O2 — CID 11953135
3-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 11953135) has the molecular formula C22H15Cl2IN2O2 and a molecular weight of 537.18 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 11953135 |
| Molecular Formula | C22H15Cl2IN2O2 |
| Molecular Weight | 537.18 g/mol |
| Exact Mass | 535.96 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[(4-chlorophenyl)methyl]-7-iodo-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1Nc2ccc(I)cc2C(=O)N(Cc2ccc(Cl)cc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15Cl2IN2O2/c23-15-5-1-13(2-6-15)12-27-20(14-3-7-16(24)8-4-14)21(28)26-19-10-9-17(25)11-18(19)22(27)29/h1-11,20H,12H2,(H,26,28) |
| InChIKey | HWHJFPMOEVEGIL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.18 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|