C24H19Cl2NO — CID 175831742
3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-6-prop-1-en-2-yl-3H-isoindol-1-one (PubChem CID 175831742) has the molecular formula C24H19Cl2NO and a molecular weight of 408.33 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-6-prop-1-en-2-yl-3H-isoindol-1-one.
| Compound Name | 3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-6-prop-1-en-2-yl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 175831742 |
| Molecular Formula | C24H19Cl2NO |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]-6-prop-1-en-2-yl-3H-isoindol-1-one |
| SMILES | C=C(C)c1ccc2c(c1)C(=O)N(Cc1ccc(Cl)cc1)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2NO/c1-15(2)18-7-12-21-22(13-18)24(28)27(14-16-3-8-19(25)9-4-16)23(21)17-5-10-20(26)11-6-17/h3-13,23H,1,14H2,2H3 |
| InChIKey | MNQZQNHWRGXJBU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |