C32H42N2O10 — CID 69345286
diethyl 5-(butan-2-ylcarbamoyl)benzene-1,3-dicarboxylate;3-ethoxycarbonyl-5-[methyl(propyl)carbamoyl]benzoic acid (PubChem CID 69345286) has the molecular formula C32H42N2O10 and a molecular weight of 614.69 g/mol. Its IUPAC name is diethyl 5-(butan-2-ylcarbamoyl)benzene-1,3-dicarboxylate;3-ethoxycarbonyl-5-[methyl(propyl)carbamoyl]benzoic acid.
| Compound Name | diethyl 5-(butan-2-ylcarbamoyl)benzene-1,3-dicarboxylate;3-ethoxycarbonyl-5-[methyl(propyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 69345286 |
| Molecular Formula | C32H42N2O10 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | diethyl 5-(butan-2-ylcarbamoyl)benzene-1,3-dicarboxylate;3-ethoxycarbonyl-5-[methyl(propyl)carbamoyl]benzoic acid |
| SMILES | CCCN(C)C(=O)c1cc(C(=O)O)cc(C(=O)OCC)c1.CCOC(=O)c1cc(C(=O)NC(C)CC)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C17H23NO5.C15H19NO5/c1-5-11(4)18-15(19)12-8-13(16(20)22-6-2)10-14(9-12)17(21)23-7-3;1-4-6-16(3)13(17)10-7-11(14(18)19)9-12(8-10)15(20)21-5-2/h8-11H,5-7H2,1-4H3,(H,18,19);7-9H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | ZBQUWMVVXONFBL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|