C30H34F2N2O4 — CID 69345522
3-[2-[amino-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(2,5-difluorophenoxy)methyl]phenyl]propanoic acid (PubChem CID 69345522) has the molecular formula C30H34F2N2O4 and a molecular weight of 524.61 g/mol. Its IUPAC name is 3-[2-[amino-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(2,5-difluorophenoxy)methyl]phenyl]propanoic acid.
| Compound Name | 3-[2-[amino-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(2,5-difluorophenoxy)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69345522 |
| Molecular Formula | C30H34F2N2O4 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[2-[amino-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(2,5-difluorophenoxy)methyl]phenyl]propanoic acid |
| SMILES | Cc1cc(C)cc([C@@H](CC(C)C)N(N)C(=O)c2cc(COc3cc(F)ccc3F)ccc2CCC(=O)O)c1 |
| InChI | InChI=1S/C30H34F2N2O4/c1-18(2)11-27(23-13-19(3)12-20(4)14-23)34(33)30(37)25-15-21(5-6-22(25)7-10-29(35)36)17-38-28-16-24(31)8-9-26(28)32/h5-6,8-9,12-16,18,27H,7,10-11,17,33H2,1-4H3,(H,35,36)/t27-/m1/s1 |
| InChIKey | AFZYUJAGKJHFNG-HHHXNRCGSA-N |
| XLogP | 6.28 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|