C29H33NO4 — CID 23017368
3-[4-[(2-methylphenoxy)methyl]-2-[(3-methyl-1-phenylbutyl)carbamoyl]phenyl]propanoic acid (PubChem CID 23017368) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-[4-[(2-methylphenoxy)methyl]-2-[(3-methyl-1-phenylbutyl)carbamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(2-methylphenoxy)methyl]-2-[(3-methyl-1-phenylbutyl)carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23017368 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 3-[4-[(2-methylphenoxy)methyl]-2-[(3-methyl-1-phenylbutyl)carbamoyl]phenyl]propanoic acid |
| SMILES | Cc1ccccc1OCc1ccc(CCC(=O)O)c(C(=O)NC(CC(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C29H33NO4/c1-20(2)17-26(24-10-5-4-6-11-24)30-29(33)25-18-22(13-14-23(25)15-16-28(31)32)19-34-27-12-8-7-9-21(27)3/h4-14,18,20,26H,15-17,19H2,1-3H3,(H,30,33)(H,31,32) |
| InChIKey | PSDMAEMSFCEEJX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |