C31H39NO2 — CID 142214087
2-butyl-N-[1-(3,5-dimethylphenyl)-3-methylbutyl]-5-phenylmethoxybenzamide (PubChem CID 142214087) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 2-butyl-N-[1-(3,5-dimethylphenyl)-3-methylbutyl]-5-phenylmethoxybenzamide.
| Compound Name | 2-butyl-N-[1-(3,5-dimethylphenyl)-3-methylbutyl]-5-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 142214087 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 2-butyl-N-[1-(3,5-dimethylphenyl)-3-methylbutyl]-5-phenylmethoxybenzamide |
| SMILES | CCCCc1ccc(OCc2ccccc2)cc1C(=O)NC(CC(C)C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C31H39NO2/c1-6-7-13-26-14-15-28(34-21-25-11-9-8-10-12-25)20-29(26)31(33)32-30(16-22(2)3)27-18-23(4)17-24(5)19-27/h8-12,14-15,17-20,22,30H,6-7,13,16,21H2,1-5H3,(H,32,33) |
| InChIKey | NYTOAXBETMHCCD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |