C30H34F3NO2 — CID 150267915
N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-2-propyl-5-[(2,3,6-trifluorophenyl)methoxy]benzamide (PubChem CID 150267915) has the molecular formula C30H34F3NO2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-2-propyl-5-[(2,3,6-trifluorophenyl)methoxy]benzamide.
| Compound Name | N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-2-propyl-5-[(2,3,6-trifluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 150267915 |
| Molecular Formula | C30H34F3NO2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-2-propyl-5-[(2,3,6-trifluorophenyl)methoxy]benzamide |
| SMILES | CCCc1ccc(OCc2c(F)ccc(F)c2F)cc1C(=O)N[C@H](CC(C)C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C30H34F3NO2/c1-6-7-21-8-9-23(36-17-25-26(31)10-11-27(32)29(25)33)16-24(21)30(35)34-28(12-18(2)3)22-14-19(4)13-20(5)15-22/h8-11,13-16,18,28H,6-7,12,17H2,1-5H3,(H,34,35)/t28-/m1/s1 |
| InChIKey | GCYALCAMTWRREV-MUUNZHRXSA-N |
| XLogP | 7.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|