C33H38F3NO2 — CID 142213867
(1R)-1-(3,5-dimethylphenyl)-N-[1-[2-(3-methoxybut-3-enyl)-5-[(2,3,6-trifluorophenyl)methoxy]phenyl]ethenyl]-3-methylbutan-1-amine (PubChem CID 142213867) has the molecular formula C33H38F3NO2 and a molecular weight of 537.67 g/mol. Its IUPAC name is (1R)-1-(3,5-dimethylphenyl)-N-[1-[2-(3-methoxybut-3-enyl)-5-[(2,3,6-trifluorophenyl)methoxy]phenyl]ethenyl]-3-methylbutan-1-amine.
| Compound Name | (1R)-1-(3,5-dimethylphenyl)-N-[1-[2-(3-methoxybut-3-enyl)-5-[(2,3,6-trifluorophenyl)methoxy]phenyl]ethenyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 142213867 |
| Molecular Formula | C33H38F3NO2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (1R)-1-(3,5-dimethylphenyl)-N-[1-[2-(3-methoxybut-3-enyl)-5-[(2,3,6-trifluorophenyl)methoxy]phenyl]ethenyl]-3-methylbutan-1-amine |
| SMILES | C=C(CCc1ccc(OCc2c(F)ccc(F)c2F)cc1C(=C)N[C@H](CC(C)C)c1cc(C)cc(C)c1)OC |
| InChI | InChI=1S/C33H38F3NO2/c1-20(2)14-32(26-16-21(3)15-22(4)17-26)37-24(6)28-18-27(11-10-25(28)9-8-23(5)38-7)39-19-29-30(34)12-13-31(35)33(29)36/h10-13,15-18,20,32,37H,5-6,8-9,14,19H2,1-4,7H3/t32-/m1/s1 |
| InChIKey | CRIUJUHKYXRSIN-JGCGQSQUSA-N |
| XLogP | 8.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|