C31H37NO4 — CID 142214166
N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-5-(3-methoxyphenoxy)-2-(4-oxobutyl)benzamide (PubChem CID 142214166) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-5-(3-methoxyphenoxy)-2-(4-oxobutyl)benzamide.
| Compound Name | N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-5-(3-methoxyphenoxy)-2-(4-oxobutyl)benzamide |
|---|---|
| PubChem CID | 142214166 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | N-[(1R)-1-(3,5-dimethylphenyl)-3-methylbutyl]-5-(3-methoxyphenoxy)-2-(4-oxobutyl)benzamide |
| SMILES | COc1cccc(Oc2ccc(CCCC=O)c(C(=O)N[C@H](CC(C)C)c3cc(C)cc(C)c3)c2)c1 |
| InChI | InChI=1S/C31H37NO4/c1-21(2)15-30(25-17-22(3)16-23(4)18-25)32-31(34)29-20-28(13-12-24(29)9-6-7-14-33)36-27-11-8-10-26(19-27)35-5/h8,10-14,16-21,30H,6-7,9,15H2,1-5H3,(H,32,34)/t30-/m1/s1 |
| InChIKey | TZSKSCPLTWKFRB-SSEXGKCCSA-N |
| XLogP | 7.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|