C29H33FN2O3 — CID 23017421
N-[1-(4-fluorophenyl)-3-methylbutyl]-2-(3-formamidopropyl)-5-(phenoxymethyl)benzamide (PubChem CID 23017421) has the molecular formula C29H33FN2O3 and a molecular weight of 476.59 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3-methylbutyl]-2-(3-formamidopropyl)-5-(phenoxymethyl)benzamide.
| Compound Name | N-[1-(4-fluorophenyl)-3-methylbutyl]-2-(3-formamidopropyl)-5-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 23017421 |
| Molecular Formula | C29H33FN2O3 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3-methylbutyl]-2-(3-formamidopropyl)-5-(phenoxymethyl)benzamide |
| SMILES | CC(C)CC(NC(=O)c1cc(COc2ccccc2)ccc1CCCNC=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H33FN2O3/c1-21(2)17-28(24-12-14-25(30)15-13-24)32-29(34)27-18-22(19-35-26-8-4-3-5-9-26)10-11-23(27)7-6-16-31-20-33/h3-5,8-15,18,20-21,28H,6-7,16-17,19H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | HMENWVKIVXGOIT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|