C30H32F3NO4 — CID 172797151
2-[2-[[1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]propanoic acid (PubChem CID 172797151) has the molecular formula C30H32F3NO4 and a molecular weight of 527.58 g/mol. Its IUPAC name is 2-[2-[[1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]propanoic acid.
| Compound Name | 2-[2-[[1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 172797151 |
| Molecular Formula | C30H32F3NO4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 2-[2-[[1-(3,5-dimethylphenyl)-3-methylbutyl]carbamoyl]-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(C)cc(C(CC(C)C)NC(=O)c2cc(OCc3cc(F)c(F)c(F)c3)ccc2C(C)C(=O)O)c1 |
| InChI | InChI=1S/C30H32F3NO4/c1-16(2)8-27(21-10-17(3)9-18(4)11-21)34-29(35)24-14-22(6-7-23(24)19(5)30(36)37)38-15-20-12-25(31)28(33)26(32)13-20/h6-7,9-14,16,19,27H,8,15H2,1-5H3,(H,34,35)(H,36,37) |
| InChIKey | QJALPTOYVQJZER-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|