C29H33NO3 — CID 23017784
3-[2-[(3-methyl-1-phenylbutyl)carbamoyl]-4-(2-phenylethyl)phenyl]propanoic acid (PubChem CID 23017784) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 3-[2-[(3-methyl-1-phenylbutyl)carbamoyl]-4-(2-phenylethyl)phenyl]propanoic acid.
| Compound Name | 3-[2-[(3-methyl-1-phenylbutyl)carbamoyl]-4-(2-phenylethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 23017784 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 3-[2-[(3-methyl-1-phenylbutyl)carbamoyl]-4-(2-phenylethyl)phenyl]propanoic acid |
| SMILES | CC(C)CC(NC(=O)c1cc(CCc2ccccc2)ccc1CCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C29H33NO3/c1-21(2)19-27(25-11-7-4-8-12-25)30-29(33)26-20-23(14-13-22-9-5-3-6-10-22)15-16-24(26)17-18-28(31)32/h3-12,15-16,20-21,27H,13-14,17-19H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | UCTYTSZFMIQHCE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |