C17H20NO2+ — CID 6934705
[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]azanium (PubChem CID 6934705) has the molecular formula C17H20NO2+ and a molecular weight of 270.35 g/mol. Its IUPAC name is [(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]azanium.
| Compound Name | [(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]azanium |
|---|---|
| PubChem CID | 6934705 |
| Molecular Formula | C17H20NO2+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]azanium |
| SMILES | [NH3+][C@H](CCc1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H19NO2/c18-15(8-6-13-4-2-1-3-5-13)14-7-9-16-17(12-14)20-11-10-19-16/h1-5,7,9,12,15H,6,8,10-11,18H2/p+1/t15-/m1/s1 |
| InChIKey | GFLHSZDRSQBEES-OAHLLOKOSA-O |
| XLogP | 2.37 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |