C19H17ClN2O5S2 — CID 69347670
3-chloro-N-[5-(4-methoxyphenyl)-2-pyridinyl]-2-methylsulfonylbenzenesulfonamide (PubChem CID 69347670) has the molecular formula C19H17ClN2O5S2 and a molecular weight of 452.94 g/mol. Its IUPAC name is 3-chloro-N-[5-(4-methoxyphenyl)-2-pyridinyl]-2-methylsulfonylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[5-(4-methoxyphenyl)-2-pyridinyl]-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 69347670 |
| Molecular Formula | C19H17ClN2O5S2 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 3-chloro-N-[5-(4-methoxyphenyl)-2-pyridinyl]-2-methylsulfonylbenzenesulfonamide |
| SMILES | COc1ccc(-c2ccc(NS(=O)(=O)c3cccc(Cl)c3S(C)(=O)=O)nc2)cc1 |
| InChI | InChI=1S/C19H17ClN2O5S2/c1-27-15-9-6-13(7-10-15)14-8-11-18(21-12-14)22-29(25,26)17-5-3-4-16(20)19(17)28(2,23)24/h3-12H,1-2H3,(H,21,22) |
| InChIKey | GEXITDXWLNFZKD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |