C5H10N2S — CID 69348749
2-cyclopropyl-1,2,5-thiadiazolidine (PubChem CID 69348749) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is 2-cyclopropyl-1,2,5-thiadiazolidine.
| Compound Name | 2-cyclopropyl-1,2,5-thiadiazolidine |
|---|---|
| PubChem CID | 69348749 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-cyclopropyl-1,2,5-thiadiazolidine |
| SMILES | C1CN(C2CC2)SN1 |
| InChI | InChI=1S/C5H10N2S/c1-2-5(1)7-4-3-6-8-7/h5-6H,1-4H2 |
| InChIKey | ABYQWKHEGWOEKD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|