C4H10N2S — CID 70086730
2,3-dimethyl-1,2,5-thiadiazolidine (PubChem CID 70086730) has the molecular formula C4H10N2S and a molecular weight of 118.20 g/mol. Its IUPAC name is 2,3-dimethyl-1,2,5-thiadiazolidine.
| Compound Name | 2,3-dimethyl-1,2,5-thiadiazolidine |
|---|---|
| PubChem CID | 70086730 |
| Molecular Formula | C4H10N2S |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 2,3-dimethyl-1,2,5-thiadiazolidine |
| SMILES | CC1CNSN1C |
| InChI | InChI=1S/C4H10N2S/c1-4-3-5-7-6(4)2/h4-5H,3H2,1-2H3 |
| InChIKey | XGVISOCADYIQPW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|