About 5H-pyrazino[2,3-b]azepine
5H-pyrazino[2,3-b]azepine (PubChem CID 69349938) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 5H-pyrazino[2,3-b]azepine.
Molecular Properties
| Compound Name | 5H-pyrazino[2,3-b]azepine |
| PubChem CID | 69349938 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 5H-pyrazino[2,3-b]azepine |
| SMILES | C1=CNc2nccnc2C=C1 |
| InChI | InChI=1S/C8H7N3/c1-2-4-10-8-7(3-1)9-5-6-11-8/h1-6H,(H,10,11) |
| InChIKey | AHKIFJNKRVQALT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrazino[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrazino[2,3-b]azepine?
The IUPAC name of 5H-pyrazino[2,3-b]azepine (CID 69349938) is 5H-pyrazino[2,3-b]azepine.
What is the SMILES notation for 5H-pyrazino[2,3-b]azepine?
The canonical SMILES for 5H-pyrazino[2,3-b]azepine is C1=CNc2nccnc2C=C1.
What is the InChIKey of 5H-pyrazino[2,3-b]azepine?
The InChIKey is AHKIFJNKRVQALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-2-4-10-8-7(3-1)9-5-6-11-8/h1-6H,(H,10,11).
What are the key properties of 5H-pyrazino[2,3-b]azepine?
5H-pyrazino[2,3-b]azepine has a molecular weight of 145.16 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrazino[2,3-b]azepine is sourced from PubChem (CID 69349938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).