C7H6N4 — CID 69350456
1H-pyrazino[2,3-c]diazepine (PubChem CID 69350456) has the molecular formula C7H6N4 and a molecular weight of 146.15 g/mol. Its IUPAC name is 1H-pyrazino[2,3-c]diazepine.
| Compound Name | 1H-pyrazino[2,3-c]diazepine |
|---|---|
| PubChem CID | 69350456 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1H-pyrazino[2,3-c]diazepine |
| SMILES | C1=Cc2nccnc2NN=C1 |
| InChI | InChI=1S/C7H6N4/c1-2-6-7(11-10-3-1)9-5-4-8-6/h1-5H,(H,9,11) |
| InChIKey | VLIHWLHGWSAALE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |