C19H20Cl2N2O4S — CID 69350386
2-[4-chloro-2-[[4-(3-chlorophenyl)sulfinylpiperazin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 69350386) has the molecular formula C19H20Cl2N2O4S and a molecular weight of 443.35 g/mol. Its IUPAC name is 2-[4-chloro-2-[[4-(3-chlorophenyl)sulfinylpiperazin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[[4-(3-chlorophenyl)sulfinylpiperazin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 69350386 |
| Molecular Formula | C19H20Cl2N2O4S |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[4-chloro-2-[[4-(3-chlorophenyl)sulfinylpiperazin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Cl)cc1CN1CCN(S(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O4S/c20-15-2-1-3-17(11-15)28(26)23-8-6-22(7-9-23)12-14-10-16(21)4-5-18(14)27-13-19(24)25/h1-5,10-11H,6-9,12-13H2,(H,24,25) |
| InChIKey | KALBQDSLTZDHDN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |