C19H20ClFN2O5S — CID 11655157
2-[4-chloro-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 11655157) has the molecular formula C19H20ClFN2O5S and a molecular weight of 442.90 g/mol. Its IUPAC name is 2-[4-chloro-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11655157 |
| Molecular Formula | C19H20ClFN2O5S |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[4-chloro-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Cl)cc1CN1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H20ClFN2O5S/c20-15-4-5-18(28-13-19(24)25)14(10-15)12-22-6-8-23(9-7-22)29(26,27)17-3-1-2-16(21)11-17/h1-5,10-11H,6-9,12-13H2,(H,24,25) |
| InChIKey | ZCMJPFSXDXFBES-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |