C21H20ClF3N2O6S — CID 140537615
[2-[2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-4-chlorophenoxy]acetyl] 2,2,2-trifluoroacetate (PubChem CID 140537615) has the molecular formula C21H20ClF3N2O6S and a molecular weight of 520.91 g/mol. Its IUPAC name is [2-[2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-4-chlorophenoxy]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-4-chlorophenoxy]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140537615 |
| Molecular Formula | C21H20ClF3N2O6S |
| Molecular Weight | 520.91 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [2-[2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-4-chlorophenoxy]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(COc1ccc(Cl)cc1CN1CCN(S(=O)(=O)c2ccccc2)CC1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H20ClF3N2O6S/c22-16-6-7-18(32-14-19(28)33-20(29)21(23,24)25)15(12-16)13-26-8-10-27(11-9-26)34(30,31)17-4-2-1-3-5-17/h1-7,12H,8-11,13-14H2 |
| InChIKey | RRGQVUKQKRYUBJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|