C23H32O4 — CID 69351296
(1R,2S,3S,5S,6S,7S,10S,11R)-6-(3,3-dihydroxypropyl)-6-hydroxy-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-dien-14-one (PubChem CID 69351296) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1R,2S,3S,5S,6S,7S,10S,11R)-6-(3,3-dihydroxypropyl)-6-hydroxy-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-dien-14-one.
| Compound Name | (1R,2S,3S,5S,6S,7S,10S,11R)-6-(3,3-dihydroxypropyl)-6-hydroxy-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-dien-14-one |
|---|---|
| PubChem CID | 69351296 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1R,2S,3S,5S,6S,7S,10S,11R)-6-(3,3-dihydroxypropyl)-6-hydroxy-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-dien-14-one |
| SMILES | C[C@]12CCC(=O)C=C1C=C[C@H]1[C@@H]3[C@@H]4C[C@@H]4[C@@](O)(CCC(O)O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H32O4/c1-21-8-5-14(24)11-13(21)3-4-15-17(21)6-9-22(2)20(15)16-12-18(16)23(22,27)10-7-19(25)26/h3-4,11,15-20,25-27H,5-10,12H2,1-2H3/t15-,16-,17+,18+,20-,21+,22+,23+/m1/s1 |
| InChIKey | AIRMUDUGMZGGOL-PJPXKQQPSA-N |
| XLogP | 2.97 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|