C26H30ClN3O2 — CID 69353335
2-chloro-N-[3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]phenyl]acetamide (PubChem CID 69353335) has the molecular formula C26H30ClN3O2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-chloro-N-[3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 69353335 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-chloro-N-[3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]phenyl]acetamide |
| SMILES | Cc1ccc2c(OCCN3CCC(Cc4cccc(NC(=O)CCl)c4)CC3)cccc2n1 |
| InChI | InChI=1S/C26H30ClN3O2/c1-19-8-9-23-24(28-19)6-3-7-25(23)32-15-14-30-12-10-20(11-13-30)16-21-4-2-5-22(17-21)29-26(31)18-27/h2-9,17,20H,10-16,18H2,1H3,(H,29,31) |
| InChIKey | RTAPUHICBJUENP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|