C30H37N3O2 — CID 10195487
N-cyclopentyl-3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]benzamide (PubChem CID 10195487) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-cyclopentyl-3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]benzamide.
| Compound Name | N-cyclopentyl-3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10195487 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | N-cyclopentyl-3-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-yl]methyl]benzamide |
| SMILES | Cc1ccc2c(OCCN3CCC(Cc4cccc(C(=O)NC5CCCC5)c4)CC3)cccc2n1 |
| InChI | InChI=1S/C30H37N3O2/c1-22-12-13-27-28(31-22)10-5-11-29(27)35-19-18-33-16-14-23(15-17-33)20-24-6-4-7-25(21-24)30(34)32-26-8-2-3-9-26/h4-7,10-13,21,23,26H,2-3,8-9,14-20H2,1H3,(H,32,34) |
| InChIKey | VSTIFXOWQXCXBA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |