C18H17ClF3N3O2 — CID 69355695
6-(5-chloro-2-hydroxyanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 69355695) has the molecular formula C18H17ClF3N3O2 and a molecular weight of 399.80 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 6-(5-chloro-2-hydroxyanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69355695 |
| Molecular Formula | C18H17ClF3N3O2 |
| Molecular Weight | 399.80 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 6-(5-chloro-2-hydroxyanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCC1)c1cnc(Nc2cc(Cl)ccc2O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17ClF3N3O2/c19-11-4-5-15(26)14(6-11)25-16-7-13(18(20,21)22)12(9-23-16)17(27)24-8-10-2-1-3-10/h4-7,9-10,26H,1-3,8H2,(H,23,25)(H,24,27) |
| InChIKey | ARQXSSPIBSIJGH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|