C18H18F3N3O — CID 69354686
6-anilino-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 69354686) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is 6-anilino-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 6-anilino-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69354686 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 6-anilino-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCC1)c1cnc(Nc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O/c19-18(20,21)15-9-16(24-13-7-2-1-3-8-13)22-11-14(15)17(25)23-10-12-5-4-6-12/h1-3,7-9,11-12H,4-6,10H2,(H,22,24)(H,23,25) |
| InChIKey | DWSJUBQDBMFOQB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |