C30H48N4O4S — CID 69357836
3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)-N-[(2S,3S)-4-(heptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]benzamide (PubChem CID 69357836) has the molecular formula C30H48N4O4S and a molecular weight of 560.81 g/mol. Its IUPAC name is 3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)-N-[(2S,3S)-4-(heptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]benzamide.
| Compound Name | 3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)-N-[(2S,3S)-4-(heptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 69357836 |
| Molecular Formula | C30H48N4O4S |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)-N-[(2S,3S)-4-(heptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]benzamide |
| SMILES | CCCCCC(C)NC[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc(NCC)cc(N2CCCCS2(O)O)c1 |
| InChI | InChI=1S/C30H48N4O4S/c1-4-6-8-13-23(3)32-22-29(35)28(18-24-14-9-7-10-15-24)33-30(36)25-19-26(31-5-2)21-27(20-25)34-16-11-12-17-39(34,37)38/h7,9-10,14-15,19-21,23,28-29,31-32,35,37-38H,4-6,8,11-13,16-18,22H2,1-3H3,(H,33,36)/t23?,28-,29-/m0/s1 |
| InChIKey | NTTDGPXOGPLUPR-MCFYZFDISA-N |
| XLogP | 5.64 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|