C27H42N4O4S — CID 69359557
N-[(2S,3R)-4-(butylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide (PubChem CID 69359557) has the molecular formula C27H42N4O4S and a molecular weight of 518.72 g/mol. Its IUPAC name is N-[(2S,3R)-4-(butylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide.
| Compound Name | N-[(2S,3R)-4-(butylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide |
|---|---|
| PubChem CID | 69359557 |
| Molecular Formula | C27H42N4O4S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | N-[(2S,3R)-4-(butylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide |
| SMILES | CCCCNC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc(NCC)cc(N2CCCCS2(O)O)c1 |
| InChI | InChI=1S/C27H42N4O4S/c1-3-5-13-28-20-26(32)25(16-21-11-7-6-8-12-21)30-27(33)22-17-23(29-4-2)19-24(18-22)31-14-9-10-15-36(31,34)35/h6-8,11-12,17-19,25-26,28-29,32,34-35H,3-5,9-10,13-16,20H2,1-2H3,(H,30,33)/t25-,26+/m0/s1 |
| InChIKey | WRWQXVKMBBSEDJ-IZZNHLLZSA-N |
| XLogP | 4.48 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|