C31H41ClN4O4S — CID 69358257
N-[(2S,3S)-4-[2-(3-chlorophenyl)ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide (PubChem CID 69358257) has the molecular formula C31H41ClN4O4S and a molecular weight of 601.21 g/mol. Its IUPAC name is N-[(2S,3S)-4-[2-(3-chlorophenyl)ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide.
| Compound Name | N-[(2S,3S)-4-[2-(3-chlorophenyl)ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide |
|---|---|
| PubChem CID | 69358257 |
| Molecular Formula | C31H41ClN4O4S |
| Molecular Weight | 601.21 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | N-[(2S,3S)-4-[2-(3-chlorophenyl)ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxythiazinan-2-yl)-5-(ethylamino)benzamide |
| SMILES | CCNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](O)CNCCc2cccc(Cl)c2)cc(N2CCCCS2(O)O)c1 |
| InChI | InChI=1S/C31H41ClN4O4S/c1-2-34-27-19-25(20-28(21-27)36-15-6-7-16-41(36,39)40)31(38)35-29(18-23-9-4-3-5-10-23)30(37)22-33-14-13-24-11-8-12-26(32)17-24/h3-5,8-12,17,19-21,29-30,33-34,37,39-40H,2,6-7,13-16,18,22H2,1H3,(H,35,38)/t29-,30-/m0/s1 |
| InChIKey | DRZITECQLZWAKY-KYJUHHDHSA-N |
| XLogP | 5.57 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.21 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|