C29H37Cl3N4O4S — CID 69361734
N-[(2S,3S)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide;hydrochloride (PubChem CID 69361734) has the molecular formula C29H37Cl3N4O4S and a molecular weight of 644.07 g/mol. Its IUPAC name is N-[(2S,3S)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide;hydrochloride.
| Compound Name | N-[(2S,3S)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 69361734 |
| Molecular Formula | C29H37Cl3N4O4S |
| Molecular Weight | 644.07 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | N-[(2S,3S)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide;hydrochloride |
| SMILES | CCNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](O)CNCc2cc(Cl)cc(Cl)c2)cc(N2CCCS2(O)O)c1.Cl |
| InChI | InChI=1S/C29H36Cl2N4O4S.ClH/c1-2-33-25-14-22(15-26(17-25)35-9-6-10-40(35,38)39)29(37)34-27(13-20-7-4-3-5-8-20)28(36)19-32-18-21-11-23(30)16-24(31)12-21;/h3-5,7-8,11-12,14-17,27-28,32-33,36,38-39H,2,6,9-10,13,18-19H2,1H3,(H,34,37);1H/t27-,28-;/m0./s1 |
| InChIKey | GQISNVWXPFHWBH-DHBRAOIWSA-N |
| XLogP | 6.21 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.07 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |