C17H28N2O — CID 69358318
(2R,3S)-3-amino-4-phenyl-1-[(1-propan-2-ylcyclobutyl)amino]butan-2-ol (PubChem CID 69358318) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-phenyl-1-[(1-propan-2-ylcyclobutyl)amino]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-phenyl-1-[(1-propan-2-ylcyclobutyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 69358318 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | (2R,3S)-3-amino-4-phenyl-1-[(1-propan-2-ylcyclobutyl)amino]butan-2-ol |
| SMILES | CC(C)C1(NC[C@@H](O)[C@@H](N)Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C17H28N2O/c1-13(2)17(9-6-10-17)19-12-16(20)15(18)11-14-7-4-3-5-8-14/h3-5,7-8,13,15-16,19-20H,6,9-12,18H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | XIJPLIHYKWIHHS-JKSUJKDBSA-N |
| XLogP | 2.09 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |