C29H41N5O5S — CID 69358419
8-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethyl-N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-2,3-dihydro-1H-quinoxaline-6-carboxamide (PubChem CID 69358419) has the molecular formula C29H41N5O5S and a molecular weight of 571.74 g/mol. Its IUPAC name is 8-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethyl-N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-2,3-dihydro-1H-quinoxaline-6-carboxamide.
| Compound Name | 8-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethyl-N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-2,3-dihydro-1H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 69358419 |
| Molecular Formula | C29H41N5O5S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 8-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethyl-N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-2,3-dihydro-1H-quinoxaline-6-carboxamide |
| SMILES | CCN1CCNc2c1cc(C(=O)N[C@@H](Cc1ccccc1)[C@H](O)CNC1CCOCC1)cc2N1CCCS1(=O)=O |
| InChI | InChI=1S/C29H41N5O5S/c1-2-33-13-11-30-28-25(33)18-22(19-26(28)34-12-6-16-40(34,37)38)29(36)32-24(17-21-7-4-3-5-8-21)27(35)20-31-23-9-14-39-15-10-23/h3-5,7-8,18-19,23-24,27,30-31,35H,2,6,9-17,20H2,1H3,(H,32,36)/t24-,27+/m0/s1 |
| InChIKey | JFTRUDMJKPRDKF-RPLLCQBOSA-N |
| XLogP | 1.95 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |