C25H34N2O3 — CID 69424338
N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-3-propylbenzamide (PubChem CID 69424338) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-3-propylbenzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-3-propylbenzamide |
|---|---|
| PubChem CID | 69424338 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-(oxan-4-ylamino)-1-phenylbutan-2-yl]-3-propylbenzamide |
| SMILES | CCCc1cccc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNC2CCOCC2)c1 |
| InChI | InChI=1S/C25H34N2O3/c1-2-7-19-10-6-11-21(16-19)25(29)27-23(17-20-8-4-3-5-9-20)24(28)18-26-22-12-14-30-15-13-22/h3-6,8-11,16,22-24,26,28H,2,7,12-15,17-18H2,1H3,(H,27,29)/t23-,24+/m0/s1 |
| InChIKey | AZKOLTNLWOYBMX-BJKOFHAPSA-N |
| XLogP | 3.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |