C23H27N3O5 — CID 69361664
N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-morpholin-4-yl-5-oxopentanamide (PubChem CID 69361664) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-morpholin-4-yl-5-oxopentanamide.
| Compound Name | N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-morpholin-4-yl-5-oxopentanamide |
|---|---|
| PubChem CID | 69361664 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-morpholin-4-yl-5-oxopentanamide |
| SMILES | COc1ccc(C(=O)c2cccc(N)c2NC(=O)CCCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3O5/c1-30-17-10-8-16(9-11-17)23(29)18-4-2-5-19(24)22(18)25-20(27)6-3-7-21(28)26-12-14-31-15-13-26/h2,4-5,8-11H,3,6-7,12-15,24H2,1H3,(H,25,27) |
| InChIKey | MKOOJEADEITOQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|