C24H29N3O4 — CID 69361211
N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-oxo-5-piperidin-1-ylpentanamide (PubChem CID 69361211) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-oxo-5-piperidin-1-ylpentanamide.
| Compound Name | N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-oxo-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 69361211 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[2-amino-6-(4-methoxybenzoyl)phenyl]-5-oxo-5-piperidin-1-ylpentanamide |
| SMILES | COc1ccc(C(=O)c2cccc(N)c2NC(=O)CCCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-31-18-13-11-17(12-14-18)24(30)19-7-5-8-20(25)23(19)26-21(28)9-6-10-22(29)27-15-3-2-4-16-27/h5,7-8,11-14H,2-4,6,9-10,15-16,25H2,1H3,(H,26,28) |
| InChIKey | IMSFJKISPPSZMD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|