C26H28N4O3 — CID 69361254
N-[2-amino-6-(4-methoxybenzoyl)phenyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 69361254) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[2-amino-6-(4-methoxybenzoyl)phenyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-amino-6-(4-methoxybenzoyl)phenyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 69361254 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[2-amino-6-(4-methoxybenzoyl)phenyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)c2cccc(N)c2NC(=O)C2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-33-21-10-8-18(9-11-21)25(31)22-6-4-7-23(27)24(22)29-26(32)19-12-15-30(16-13-19)17-20-5-2-3-14-28-20/h2-11,14,19H,12-13,15-17,27H2,1H3,(H,29,32) |
| InChIKey | ZFLVJRINGJSYME-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|