C17H25N3O2 — CID 1071352
N-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 1071352) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1071352 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)C1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c21-17(19-12-16-5-3-11-22-16)14-6-9-20(10-7-14)13-15-4-1-2-8-18-15/h1-2,4,8,14,16H,3,5-7,9-13H2,(H,19,21)/t16-/m1/s1 |
| InChIKey | UPEBQBIOLGJNPW-MRXNPFEDSA-N |
| XLogP | 1.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |