C16H24N4O3 — CID 171834271
(2R)-2-amino-4-[[1-(pyridin-2-ylmethyl)piperidine-4-carbonyl]amino]butanoic acid (PubChem CID 171834271) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R)-2-amino-4-[[1-(pyridin-2-ylmethyl)piperidine-4-carbonyl]amino]butanoic acid.
| Compound Name | (2R)-2-amino-4-[[1-(pyridin-2-ylmethyl)piperidine-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 171834271 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R)-2-amino-4-[[1-(pyridin-2-ylmethyl)piperidine-4-carbonyl]amino]butanoic acid |
| SMILES | N[C@H](CCNC(=O)C1CCN(Cc2ccccn2)CC1)C(=O)O |
| InChI | InChI=1S/C16H24N4O3/c17-14(16(22)23)4-8-19-15(21)12-5-9-20(10-6-12)11-13-3-1-2-7-18-13/h1-3,7,12,14H,4-6,8-11,17H2,(H,19,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | SSJHYLORYVOABJ-CQSZACIVSA-N |
| XLogP | 0.21 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |