C17H25N3O3 — CID 121496359
N-[[(2R)-oxolan-2-yl]methyl]-4-(pyridin-2-ylmethoxy)piperidine-1-carboxamide (PubChem CID 121496359) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-4-(pyridin-2-ylmethoxy)piperidine-1-carboxamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-4-(pyridin-2-ylmethoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121496359 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-4-(pyridin-2-ylmethoxy)piperidine-1-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)N1CCC(OCc2ccccn2)CC1 |
| InChI | InChI=1S/C17H25N3O3/c21-17(19-12-16-5-3-11-22-16)20-9-6-15(7-10-20)23-13-14-4-1-2-8-18-14/h1-2,4,8,15-16H,3,5-7,9-13H2,(H,19,21)/t16-/m1/s1 |
| InChIKey | HIJKGRJUQJHUFJ-MRXNPFEDSA-N |
| XLogP | 1.95 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |