C20H27N5O3 — CID 126795589
4-(oxolan-2-ylmethoxy)-N-[1-(pyridin-2-ylmethyl)pyrazol-4-yl]piperidine-1-carboxamide (PubChem CID 126795589) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethoxy)-N-[1-(pyridin-2-ylmethyl)pyrazol-4-yl]piperidine-1-carboxamide.
| Compound Name | 4-(oxolan-2-ylmethoxy)-N-[1-(pyridin-2-ylmethyl)pyrazol-4-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126795589 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-(oxolan-2-ylmethoxy)-N-[1-(pyridin-2-ylmethyl)pyrazol-4-yl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccccn2)c1)N1CCC(OCC2CCCO2)CC1 |
| InChI | InChI=1S/C20H27N5O3/c26-20(23-17-12-22-25(14-17)13-16-4-1-2-8-21-16)24-9-6-18(7-10-24)28-15-19-5-3-11-27-19/h1-2,4,8,12,14,18-19H,3,5-7,9-11,13,15H2,(H,23,26) |
| InChIKey | QZYVLPPWTYSNSC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |